C15H10F3NO2S — CID 134135798
1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1-benzothiophen-6-amine (PubChem CID 134135798) has the molecular formula C15H10F3NO2S and a molecular weight of 325.31 g/mol. Its IUPAC name is 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1-benzothiophen-6-amine.
| Compound Name | 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1-benzothiophen-6-amine |
|---|---|
| PubChem CID | 134135798 |
| Molecular Formula | C15H10F3NO2S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1-benzothiophen-6-amine |
| SMILES | O=S1(=O)C=Cc2ccc(Nc3cccc(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C15H10F3NO2S/c16-15(17,18)11-2-1-3-12(8-11)19-13-5-4-10-6-7-22(20,21)14(10)9-13/h1-9,19H |
| InChIKey | YJEOOVUAEVVVDK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |