C14H11F3N2 — CID 89261435
6-ethenyl-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine (PubChem CID 89261435) has the molecular formula C14H11F3N2 and a molecular weight of 264.25 g/mol. Its IUPAC name is 6-ethenyl-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine.
| Compound Name | 6-ethenyl-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 89261435 |
| Molecular Formula | C14H11F3N2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 6-ethenyl-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine |
| SMILES | C=Cc1ccc(Nc2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C14H11F3N2/c1-2-11-6-7-13(9-18-11)19-12-5-3-4-10(8-12)14(15,16)17/h2-9,19H,1H2 |
| InChIKey | AVOMTPFYUXDGRP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |