C24H19F4N7 — CID 58876733
4-(6-ethyl-2-pyridinyl)-5-fluoro-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine (PubChem CID 58876733) has the molecular formula C24H19F4N7 and a molecular weight of 481.46 g/mol. Its IUPAC name is 4-(6-ethyl-2-pyridinyl)-5-fluoro-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine.
| Compound Name | 4-(6-ethyl-2-pyridinyl)-5-fluoro-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58876733 |
| Molecular Formula | C24H19F4N7 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 4-(6-ethyl-2-pyridinyl)-5-fluoro-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine |
| SMILES | CCc1cccc(-c2nc(N/N=C/c3ccc(Nc4cccc(C(F)(F)F)c4)cn3)ncc2F)n1 |
| InChI | InChI=1S/C24H19F4N7/c1-2-16-6-4-8-21(33-16)22-20(25)14-30-23(34-22)35-31-13-18-9-10-19(12-29-18)32-17-7-3-5-15(11-17)24(26,27)28/h3-14,32H,2H2,1H3,(H,30,34,35)/b31-13+ |
| InChIKey | IYXACHGIKJGMQI-IURWMYGYSA-N |
| XLogP | 5.84 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|