C24H26F4N8O — CID 58876753
5-fluoro-4-N-(3-morpholin-4-ylpropyl)-2-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidine-2,4-diamine (PubChem CID 58876753) has the molecular formula C24H26F4N8O and a molecular weight of 518.52 g/mol. Its IUPAC name is 5-fluoro-4-N-(3-morpholin-4-ylpropyl)-2-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-4-N-(3-morpholin-4-ylpropyl)-2-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58876753 |
| Molecular Formula | C24H26F4N8O |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 5-fluoro-4-N-(3-morpholin-4-ylpropyl)-2-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidine-2,4-diamine |
| SMILES | Fc1cnc(N/N=C/c2ccc(Nc3cccc(C(F)(F)F)c3)cn2)nc1NCCCN1CCOCC1 |
| InChI | InChI=1S/C24H26F4N8O/c25-21-16-31-23(34-22(21)29-7-2-8-36-9-11-37-12-10-36)35-32-15-19-5-6-20(14-30-19)33-18-4-1-3-17(13-18)24(26,27)28/h1,3-6,13-16,33H,2,7-12H2,(H2,29,31,34,35)/b32-15+ |
| InChIKey | DXNCXMKAWLBJCK-VWJSQJICSA-N |
| XLogP | 4.35 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|