C26H28F4N8O — CID 91000313
5-fluoro-4-morpholin-4-yl-N-[(Z)-[5-[3-piperidin-1-yl-5-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine (PubChem CID 91000313) has the molecular formula C26H28F4N8O and a molecular weight of 544.56 g/mol. Its IUPAC name is 5-fluoro-4-morpholin-4-yl-N-[(Z)-[5-[3-piperidin-1-yl-5-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-morpholin-4-yl-N-[(Z)-[5-[3-piperidin-1-yl-5-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 91000313 |
| Molecular Formula | C26H28F4N8O |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 5-fluoro-4-morpholin-4-yl-N-[(Z)-[5-[3-piperidin-1-yl-5-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine |
| SMILES | Fc1cnc(N/N=C\c2ccc(Nc3cc(N4CCCCC4)cc(C(F)(F)F)c3)cn2)nc1N1CCOCC1 |
| InChI | InChI=1S/C26H28F4N8O/c27-23-17-32-25(35-24(23)38-8-10-39-11-9-38)36-33-16-19-4-5-20(15-31-19)34-21-12-18(26(28,29)30)13-22(14-21)37-6-2-1-3-7-37/h4-5,12-17,34H,1-3,6-11H2,(H,32,35,36)/b33-16- |
| InChIKey | AVQBMVXHHHPPJA-BJUCDSOZSA-N |
| XLogP | 5.05 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|