C26H28F4N8O — CID 172932503
5-fluoro-4-morpholin-4-yl-N-[(E)-[5-[4-piperidin-4-yl-3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine (PubChem CID 172932503) has the molecular formula C26H28F4N8O and a molecular weight of 544.56 g/mol. Its IUPAC name is 5-fluoro-4-morpholin-4-yl-N-[(E)-[5-[4-piperidin-4-yl-3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-morpholin-4-yl-N-[(E)-[5-[4-piperidin-4-yl-3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 172932503 |
| Molecular Formula | C26H28F4N8O |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 5-fluoro-4-morpholin-4-yl-N-[(E)-[5-[4-piperidin-4-yl-3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]pyrimidin-2-amine |
| SMILES | Fc1cnc(N/N=C/c2ccc(Nc3ccc(C4CCNCC4)c(C(F)(F)F)c3)cn2)nc1N1CCOCC1 |
| InChI | InChI=1S/C26H28F4N8O/c27-23-16-33-25(36-24(23)38-9-11-39-12-10-38)37-34-15-19-1-2-20(14-32-19)35-18-3-4-21(17-5-7-31-8-6-17)22(13-18)26(28,29)30/h1-4,13-17,31,35H,5-12H2,(H,33,36,37)/b34-15+ |
| InChIKey | MPVQIVTYXSUGLD-PUHLOBNQSA-N |
| XLogP | 4.52 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|