C28H28FN7O2 — CID 70951265
3-[[4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-2-methylphenyl]methyl]phenol (PubChem CID 70951265) has the molecular formula C28H28FN7O2 and a molecular weight of 513.58 g/mol. Its IUPAC name is 3-[[4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-2-methylphenyl]methyl]phenol.
| Compound Name | 3-[[4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-2-methylphenyl]methyl]phenol |
|---|---|
| PubChem CID | 70951265 |
| Molecular Formula | C28H28FN7O2 |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 3-[[4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-2-methylphenyl]methyl]phenol |
| SMILES | Cc1cc(Nc2ccc(/C=N\Nc3ncc(F)c(N4CCOCC4)n3)nc2)ccc1Cc1cccc(O)c1 |
| InChI | InChI=1S/C28H28FN7O2/c1-19-13-22(6-5-21(19)14-20-3-2-4-25(37)15-20)33-24-8-7-23(30-16-24)17-32-35-28-31-18-26(29)27(34-28)36-9-11-38-12-10-36/h2-8,13,15-18,33,37H,9-12,14H2,1H3,(H,31,34,35)/b32-17- |
| InChIKey | VRVMDSHKVNOCPT-KYHGBAKBSA-N |
| XLogP | 4.64 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|