C28H25ClFN7O3 — CID 90886632
1-[2-chloro-4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]-2-(3-hydroxyphenyl)ethanone (PubChem CID 90886632) has the molecular formula C28H25ClFN7O3 and a molecular weight of 562.01 g/mol. Its IUPAC name is 1-[2-chloro-4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]-2-(3-hydroxyphenyl)ethanone.
| Compound Name | 1-[2-chloro-4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]-2-(3-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 90886632 |
| Molecular Formula | C28H25ClFN7O3 |
| Molecular Weight | 562.01 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 1-[2-chloro-4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]-2-(3-hydroxyphenyl)ethanone |
| SMILES | O=C(Cc1cccc(O)c1)c1ccc(Nc2ccc(/C=N\Nc3ncc(F)c(N4CCOCC4)n3)nc2)cc1Cl |
| InChI | InChI=1S/C28H25ClFN7O3/c29-24-14-19(6-7-23(24)26(39)13-18-2-1-3-22(38)12-18)34-21-5-4-20(31-15-21)16-33-36-28-32-17-25(30)27(35-28)37-8-10-40-11-9-37/h1-7,12,14-17,34,38H,8-11,13H2,(H,32,35,36)/b33-16- |
| InChIKey | XHEHYAUAKQLMSR-BJUCDSOZSA-N |
| XLogP | 4.82 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.01 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|