C29H31ClFN7O3 — CID 143471107
N-[(E)-[5-(3-chloro-5-ethylanilino)-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine;5-methylbenzene-1,3-diol (PubChem CID 143471107) has the molecular formula C29H31ClFN7O3 and a molecular weight of 580.06 g/mol. Its IUPAC name is N-[(E)-[5-(3-chloro-5-ethylanilino)-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine;5-methylbenzene-1,3-diol.
| Compound Name | N-[(E)-[5-(3-chloro-5-ethylanilino)-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine;5-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 143471107 |
| Molecular Formula | C29H31ClFN7O3 |
| Molecular Weight | 580.06 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | N-[(E)-[5-(3-chloro-5-ethylanilino)-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine;5-methylbenzene-1,3-diol |
| SMILES | CCc1cc(Cl)cc(Nc2ccc(/C=N/Nc3ncc(F)c(N4CCOCC4)n3)nc2)c1.Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C22H23ClFN7O.C7H8O2/c1-2-15-9-16(23)11-19(10-15)28-18-4-3-17(25-12-18)13-27-30-22-26-14-20(24)21(29-22)31-5-7-32-8-6-31;1-5-2-6(8)4-7(9)3-5/h3-4,9-14,28H,2,5-8H2,1H3,(H,26,29,30);2-4,8-9H,1H3/b27-13+; |
| InChIKey | RJWJQGLOMUHAQJ-LPUIDCEHSA-N |
| XLogP | 5.66 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.06 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|