C27H26FN7O4S — CID 89112947
3-[4-[[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-2-methylphenyl]sulfonylphenol (PubChem CID 89112947) has the molecular formula C27H26FN7O4S and a molecular weight of 563.62 g/mol. Its IUPAC name is 3-[4-[[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-2-methylphenyl]sulfonylphenol.
| Compound Name | 3-[4-[[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-2-methylphenyl]sulfonylphenol |
|---|---|
| PubChem CID | 89112947 |
| Molecular Formula | C27H26FN7O4S |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 3-[4-[[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-2-methylphenyl]sulfonylphenol |
| SMILES | Cc1cc(Nc2ccc(/C=N/Nc3ncc(F)c(N4CCOCC4)n3)nc2)ccc1S(=O)(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C27H26FN7O4S/c1-18-13-19(7-8-25(18)40(37,38)23-4-2-3-22(36)14-23)32-21-6-5-20(29-15-21)16-31-34-27-30-17-24(28)26(33-27)35-9-11-39-12-10-35/h2-8,13-17,32,36H,9-12H2,1H3,(H,30,33,34)/b31-16+ |
| InChIKey | XUZQJASBCWQEAW-WCMJOSRZSA-N |
| XLogP | 3.88 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|