C27H25ClFN7O2 — CID 58877230
3-[2-chloro-4-[[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-methyl-3-pyridinyl]amino]phenyl]phenol (PubChem CID 58877230) has the molecular formula C27H25ClFN7O2 and a molecular weight of 534.00 g/mol. Its IUPAC name is 3-[2-chloro-4-[[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-methyl-3-pyridinyl]amino]phenyl]phenol.
| Compound Name | 3-[2-chloro-4-[[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-methyl-3-pyridinyl]amino]phenyl]phenol |
|---|---|
| PubChem CID | 58877230 |
| Molecular Formula | C27H25ClFN7O2 |
| Molecular Weight | 534.00 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 3-[2-chloro-4-[[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-methyl-3-pyridinyl]amino]phenyl]phenol |
| SMILES | Cc1cc(/C=N/Nc2ncc(F)c(N3CCOCC3)n2)ncc1Nc1ccc(-c2cccc(O)c2)c(Cl)c1 |
| InChI | InChI=1S/C27H25ClFN7O2/c1-17-11-20(14-32-35-27-31-15-24(29)26(34-27)36-7-9-38-10-8-36)30-16-25(17)33-19-5-6-22(23(28)13-19)18-3-2-4-21(37)12-18/h2-6,11-16,33,37H,7-10H2,1H3,(H,31,34,35)/b32-14+ |
| InChIKey | FDAHSQGIXOGSPA-HIWRWHBISA-N |
| XLogP | 5.37 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.00 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|