C22H19ClF3IN5O2- — CID 172923980
CID 172923980 (PubChem CID 172923980) has the molecular formula C22H19ClF3IN5O2- and a molecular weight of 604.78 g/mol.
| Compound Name | CID 172923980 |
|---|---|
| PubChem CID | 172923980 |
| Molecular Formula | C22H19ClF3IN5O2- |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.02 |
| IUPAC Name | — |
| SMILES | Oc1c(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)ccc(-c2cccc(C(F)(F)[IH-])c2)c1Cl |
| InChI | InChI=1S/C22H18ClF3IN5O2/c23-18-16(13-2-1-3-15(10-13)22(25,26)27)5-4-14(19(18)33)11-29-31-21-28-12-17(24)20(30-21)32-6-8-34-9-7-32/h1-5,10-12,33H,6-9H2,(H,28,30,31)/q-1/b29-11- |
| InChIKey | MPJCHMXEFFHVKQ-KYMQWJLESA-N |
| XLogP | 1.26 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|