C15H16BrFN6O2 — CID 136633987
2-amino-4-bromo-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 136633987) has the molecular formula C15H16BrFN6O2 and a molecular weight of 411.24 g/mol. Its IUPAC name is 2-amino-4-bromo-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-amino-4-bromo-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136633987 |
| Molecular Formula | C15H16BrFN6O2 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-amino-4-bromo-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Nc1cc(Br)cc(/C=N/Nc2ncc(F)c(N3CCOCC3)n2)c1O |
| InChI | InChI=1S/C15H16BrFN6O2/c16-10-5-9(13(24)12(18)6-10)7-20-22-15-19-8-11(17)14(21-15)23-1-3-25-4-2-23/h5-8,24H,1-4,18H2,(H,19,21,22)/b20-7+ |
| InChIKey | IOJOGEDKXGJWIH-IFRROFPPSA-N |
| XLogP | 1.95 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|