C31H26BrFN6O — CID 3111583
N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 3111583) has the molecular formula C31H26BrFN6O and a molecular weight of 597.49 g/mol. Its IUPAC name is N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 3111583 |
| Molecular Formula | C31H26BrFN6O |
| Molecular Weight | 597.49 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Fc1cnc(NN=Cc2cc(-c3ccccc3)n(-c3ccc(Br)cc3)c2-c2ccccc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C31H26BrFN6O/c32-25-11-13-26(14-12-25)39-28(22-7-3-1-4-8-22)19-24(29(39)23-9-5-2-6-10-23)20-35-37-31-34-21-27(33)30(36-31)38-15-17-40-18-16-38/h1-14,19-21H,15-18H2,(H,34,36,37) |
| InChIKey | CAMCHFDQBXIFLS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.49 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|