C22H20ClF3N5O2P — CID 138508473
2-chloro-4-[3-[difluoro(phosphanyl)methyl]phenyl]-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 138508473) has the molecular formula C22H20ClF3N5O2P and a molecular weight of 509.86 g/mol. Its IUPAC name is 2-chloro-4-[3-[difluoro(phosphanyl)methyl]phenyl]-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-chloro-4-[3-[difluoro(phosphanyl)methyl]phenyl]-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 138508473 |
| Molecular Formula | C22H20ClF3N5O2P |
| Molecular Weight | 509.86 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 2-chloro-4-[3-[difluoro(phosphanyl)methyl]phenyl]-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Cl)cc(-c2cccc(C(F)(F)P)c2)cc1/C=N\Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H20ClF3N5O2P/c23-17-10-14(13-2-1-3-16(9-13)22(25,26)34)8-15(19(17)32)11-28-30-21-27-12-18(24)20(29-21)31-4-6-33-7-5-31/h1-3,8-12,32H,4-7,34H2,(H,27,29,30)/b28-11- |
| InChIKey | QWKRVSDXZYLTRI-FXMZOFOKSA-N |
| XLogP | 4.85 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.86 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|