C24H21ClF4N6O3 — CID 143471080
3-chloro-5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-hydroxy-N-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]benzamide (PubChem CID 143471080) has the molecular formula C24H21ClF4N6O3 and a molecular weight of 552.92 g/mol. Its IUPAC name is 3-chloro-5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-hydroxy-N-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]benzamide.
| Compound Name | 3-chloro-5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-hydroxy-N-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]benzamide |
|---|---|
| PubChem CID | 143471080 |
| Molecular Formula | C24H21ClF4N6O3 |
| Molecular Weight | 552.92 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 3-chloro-5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-hydroxy-N-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]benzamide |
| SMILES | O=C(NC1=CCC=CC(C(F)(F)F)=C1)c1cc(Cl)c(O)c(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C24H21ClF4N6O3/c25-18-10-14(22(37)32-17-4-2-1-3-16(11-17)24(27,28)29)9-15(20(18)36)12-31-34-23-30-13-19(26)21(33-23)35-5-7-38-8-6-35/h1,3-4,9-13,36H,2,5-8H2,(H,32,37)(H,30,33,34)/b31-12- |
| InChIKey | BEOGLTCMVWLLBI-HCNMGLPWSA-N |
| XLogP | 4.32 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.92 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|