C19H22FN7O3 — CID 118070379
5-fluoro-4-morpholin-4-yl-N-[(Z)-(4-morpholin-4-yl-3-nitrosophenyl)methylideneamino]pyrimidin-2-amine (PubChem CID 118070379) has the molecular formula C19H22FN7O3 and a molecular weight of 415.43 g/mol. Its IUPAC name is 5-fluoro-4-morpholin-4-yl-N-[(Z)-(4-morpholin-4-yl-3-nitrosophenyl)methylideneamino]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-morpholin-4-yl-N-[(Z)-(4-morpholin-4-yl-3-nitrosophenyl)methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 118070379 |
| Molecular Formula | C19H22FN7O3 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 5-fluoro-4-morpholin-4-yl-N-[(Z)-(4-morpholin-4-yl-3-nitrosophenyl)methylideneamino]pyrimidin-2-amine |
| SMILES | O=Nc1cc(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H22FN7O3/c20-15-13-21-19(23-18(15)27-5-9-30-10-6-27)24-22-12-14-1-2-17(16(11-14)25-28)26-3-7-29-8-4-26/h1-2,11-13H,3-10H2,(H,21,23,24)/b22-12- |
| InChIKey | GXMXBJREECYURJ-UUYOSTAYSA-N |
| XLogP | 2.13 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|