C17H19FN6O3 — CID 126221378
2-[4-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 126221378) has the molecular formula C17H19FN6O3 and a molecular weight of 374.38 g/mol. Its IUPAC name is 2-[4-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126221378 |
| Molecular Formula | C17H19FN6O3 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[4-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C17H19FN6O3/c18-14-10-20-17(22-16(14)24-5-7-26-8-6-24)23-21-9-12-1-3-13(4-2-12)27-11-15(19)25/h1-4,9-10H,5-8,11H2,(H2,19,25)(H,20,22,23)/b21-9- |
| InChIKey | XXPFJTFQWXNKKM-NKVSQWTQSA-N |
| XLogP | 0.76 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|