C20H18ClFN6O3 — CID 89362016
2-chloro-5-[5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzamide (PubChem CID 89362016) has the molecular formula C20H18ClFN6O3 and a molecular weight of 444.85 g/mol. Its IUPAC name is 2-chloro-5-[5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzamide.
| Compound Name | 2-chloro-5-[5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzamide |
|---|---|
| PubChem CID | 89362016 |
| Molecular Formula | C20H18ClFN6O3 |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-chloro-5-[5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzamide |
| SMILES | NC(=O)c1cc(-c2ccc(/C=N\Nc3ncc(F)c(N4CCOCC4)n3)o2)ccc1Cl |
| InChI | InChI=1S/C20H18ClFN6O3/c21-15-3-1-12(9-14(15)18(23)29)17-4-2-13(31-17)10-25-27-20-24-11-16(22)19(26-20)28-5-7-30-8-6-28/h1-4,9-11H,5-8H2,(H2,23,29)(H,24,26,27)/b25-10- |
| InChIKey | OBLHISLXOQODBN-MRUKODCESA-N |
| XLogP | 2.91 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|