C19H16FIN5O4- — CID 172940635
CID 172940635 (PubChem CID 172940635) has the molecular formula C19H16FIN5O4- and a molecular weight of 524.27 g/mol.
| Compound Name | CID 172940635 |
|---|---|
| PubChem CID | 172940635 |
| Molecular Formula | C19H16FIN5O4- |
| Molecular Weight | 524.27 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cccc(-c2ccc(/C=N/Nc3ncc(F)c(N4CCO[I-]C4)n3)o2)c1 |
| InChI | InChI=1S/C19H16FIN5O4/c20-15-10-22-19(24-17(15)26-6-7-29-21-11-26)25-23-9-14-4-5-16(30-14)12-2-1-3-13(8-12)18(27)28/h1-5,8-10H,6-7,11H2,(H,27,28)(H,22,24,25)/q-1/b23-9+ |
| InChIKey | NBYORKNVQMXIKL-NUGSKGIGSA-N |
| XLogP | -0.18 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|