C23H24F3N7O2 — CID 34360960
4-morpholin-4-yl-6-pyrrolidin-1-yl-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1,3,5-triazin-2-amine (PubChem CID 34360960) has the molecular formula C23H24F3N7O2 and a molecular weight of 487.49 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-pyrrolidin-1-yl-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1,3,5-triazin-2-amine.
| Compound Name | 4-morpholin-4-yl-6-pyrrolidin-1-yl-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 34360960 |
| Molecular Formula | C23H24F3N7O2 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 4-morpholin-4-yl-6-pyrrolidin-1-yl-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)c1cccc(-c2ccc(/C=N/Nc3nc(N4CCCC4)nc(N4CCOCC4)n3)o2)c1 |
| InChI | InChI=1S/C23H24F3N7O2/c24-23(25,26)17-5-3-4-16(14-17)19-7-6-18(35-19)15-27-31-20-28-21(32-8-1-2-9-32)30-22(29-20)33-10-12-34-13-11-33/h3-7,14-15H,1-2,8-13H2,(H,28,29,30,31)/b27-15+ |
| InChIKey | UVVPHBMWUUMAIE-JFLMPSFJSA-N |
| XLogP | 4.03 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|