C29H29FN6O2 — CID 58877270
3-[3-[3-ethyl-4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]anilino]phenyl]phenol (PubChem CID 58877270) has the molecular formula C29H29FN6O2 and a molecular weight of 512.59 g/mol. Its IUPAC name is 3-[3-[3-ethyl-4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]anilino]phenyl]phenol.
| Compound Name | 3-[3-[3-ethyl-4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]anilino]phenyl]phenol |
|---|---|
| PubChem CID | 58877270 |
| Molecular Formula | C29H29FN6O2 |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 3-[3-[3-ethyl-4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]anilino]phenyl]phenol |
| SMILES | CCc1cc(Nc2cccc(-c3cccc(O)c3)c2)ccc1/C=N/Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C29H29FN6O2/c1-2-20-15-25(33-24-7-3-5-21(16-24)22-6-4-8-26(37)17-22)10-9-23(20)18-32-35-29-31-19-27(30)28(34-29)36-11-13-38-14-12-36/h3-10,15-19,33,37H,2,11-14H2,1H3,(H,31,34,35)/b32-18+ |
| InChIKey | IFPBNRYZJCAWJU-KCSSXMTESA-N |
| XLogP | 5.58 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|