C31H33FN6O2 — CID 58877110
3-[3-[4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-(2-methylpropyl)anilino]phenyl]phenol (PubChem CID 58877110) has the molecular formula C31H33FN6O2 and a molecular weight of 540.64 g/mol. Its IUPAC name is 3-[3-[4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-(2-methylpropyl)anilino]phenyl]phenol.
| Compound Name | 3-[3-[4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-(2-methylpropyl)anilino]phenyl]phenol |
|---|---|
| PubChem CID | 58877110 |
| Molecular Formula | C31H33FN6O2 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 3-[3-[4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-(2-methylpropyl)anilino]phenyl]phenol |
| SMILES | CC(C)Cc1cc(Nc2cccc(-c3cccc(O)c3)c2)ccc1/C=N/Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C31H33FN6O2/c1-21(2)15-25-17-27(35-26-7-3-5-22(16-26)23-6-4-8-28(39)18-23)10-9-24(25)19-34-37-31-33-20-29(32)30(36-31)38-11-13-40-14-12-38/h3-10,16-21,35,39H,11-15H2,1-2H3,(H,33,36,37)/b34-19+ |
| InChIKey | YGRMHJONAAZRQN-ALQBTCKLSA-N |
| XLogP | 6.21 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|