C27H26FN7O2 — CID 70951263
3-[[3-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]methyl]phenol (PubChem CID 70951263) has the molecular formula C27H26FN7O2 and a molecular weight of 499.55 g/mol. Its IUPAC name is 3-[[3-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]methyl]phenol.
| Compound Name | 3-[[3-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 70951263 |
| Molecular Formula | C27H26FN7O2 |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 3-[[3-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]methyl]phenol |
| SMILES | Oc1cccc(Cc2cccc(Nc3ccc(/C=N\Nc4ncc(F)c(N5CCOCC5)n4)nc3)c2)c1 |
| InChI | InChI=1S/C27H26FN7O2/c28-25-18-30-27(33-26(25)35-9-11-37-12-10-35)34-31-17-22-7-8-23(16-29-22)32-21-5-1-3-19(14-21)13-20-4-2-6-24(36)15-20/h1-8,14-18,32,36H,9-13H2,(H,30,33,34)/b31-17- |
| InChIKey | DWRSCXDCFIGNLZ-LJUMEUDFSA-N |
| XLogP | 4.33 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|