C27H26ClFN8O — CID 143430933
3-N-(3-chloro-5-methylphenyl)-1-N-[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]benzene-1,3-diamine (PubChem CID 143430933) has the molecular formula C27H26ClFN8O and a molecular weight of 533.01 g/mol. Its IUPAC name is 3-N-(3-chloro-5-methylphenyl)-1-N-[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]benzene-1,3-diamine.
| Compound Name | 3-N-(3-chloro-5-methylphenyl)-1-N-[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 143430933 |
| Molecular Formula | C27H26ClFN8O |
| Molecular Weight | 533.01 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 3-N-(3-chloro-5-methylphenyl)-1-N-[6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]benzene-1,3-diamine |
| SMILES | Cc1cc(Cl)cc(Nc2cccc(Nc3ccc(/C=N/Nc4ncc(F)c(N5CCOCC5)n4)nc3)c2)c1 |
| InChI | InChI=1S/C27H26ClFN8O/c1-18-11-19(28)13-24(12-18)34-21-4-2-3-20(14-21)33-23-6-5-22(30-15-23)16-32-36-27-31-17-25(29)26(35-27)37-7-9-38-10-8-37/h2-6,11-17,33-34H,7-10H2,1H3,(H,31,35,36)/b32-16+ |
| InChIKey | MEAMIHIRLVRZFD-KPGMTVGESA-N |
| XLogP | 5.74 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.01 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|