C25H24FN9O — CID 58877214
5-fluoro-N-[(E)-[5-(3-methyl-5-pyridazin-3-ylanilino)-2-pyridinyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 58877214) has the molecular formula C25H24FN9O and a molecular weight of 485.53 g/mol. Its IUPAC name is 5-fluoro-N-[(E)-[5-(3-methyl-5-pyridazin-3-ylanilino)-2-pyridinyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(E)-[5-(3-methyl-5-pyridazin-3-ylanilino)-2-pyridinyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 58877214 |
| Molecular Formula | C25H24FN9O |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 5-fluoro-N-[(E)-[5-(3-methyl-5-pyridazin-3-ylanilino)-2-pyridinyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Cc1cc(Nc2ccc(/C=N/Nc3ncc(F)c(N4CCOCC4)n3)nc2)cc(-c2cccnn2)c1 |
| InChI | InChI=1S/C25H24FN9O/c1-17-11-18(23-3-2-6-29-33-23)13-21(12-17)31-20-5-4-19(27-14-20)15-30-34-25-28-16-22(26)24(32-25)35-7-9-36-10-8-35/h2-6,11-16,31H,7-10H2,1H3,(H,28,32,34)/b30-15+ |
| InChIKey | DAKXRHJZHMEPMT-FJEPWZHXSA-N |
| XLogP | 3.80 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|