C20H25FN6O2 — CID 129106591
5-fluoro-N-[(Z)-(3-methyl-4-morpholin-4-ylphenyl)methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 129106591) has the molecular formula C20H25FN6O2 and a molecular weight of 400.46 g/mol. Its IUPAC name is 5-fluoro-N-[(Z)-(3-methyl-4-morpholin-4-ylphenyl)methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(Z)-(3-methyl-4-morpholin-4-ylphenyl)methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 129106591 |
| Molecular Formula | C20H25FN6O2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 5-fluoro-N-[(Z)-(3-methyl-4-morpholin-4-ylphenyl)methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Cc1cc(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H25FN6O2/c1-15-12-16(2-3-18(15)26-4-8-28-9-5-26)13-23-25-20-22-14-17(21)19(24-20)27-6-10-29-11-7-27/h2-3,12-14H,4-11H2,1H3,(H,22,24,25)/b23-13- |
| InChIKey | CETJUOFXKCHAJA-QRVIBDJDSA-N |
| XLogP | 2.04 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|