C21H21ClFN7O — CID 58876846
N-[(Z)-[4-(2-chloro-6-methylanilino)-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 58876846) has the molecular formula C21H21ClFN7O and a molecular weight of 441.90 g/mol. Its IUPAC name is N-[(Z)-[4-(2-chloro-6-methylanilino)-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(Z)-[4-(2-chloro-6-methylanilino)-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 58876846 |
| Molecular Formula | C21H21ClFN7O |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[(Z)-[4-(2-chloro-6-methylanilino)-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Cc1cccc(Cl)c1Nc1ccnc(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C21H21ClFN7O/c1-14-3-2-4-17(22)19(14)27-15-5-6-24-16(11-15)12-26-29-21-25-13-18(23)20(28-21)30-7-9-31-10-8-30/h2-6,11-13H,7-10H2,1H3,(H,24,27)(H,25,28,29)/b26-12- |
| InChIKey | UYXMQQQDXNJASU-ZRGSRPPYSA-N |
| XLogP | 4.00 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|