C22H21FN6O3S — CID 44537686
5-fluoro-N-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 44537686) has the molecular formula C22H21FN6O3S and a molecular weight of 468.51 g/mol. Its IUPAC name is 5-fluoro-N-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 44537686 |
| Molecular Formula | C22H21FN6O3S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 5-fluoro-N-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Cc1ccc(Sc2ccc(/C=N/Nc3ncc(F)c(N4CCOCC4)n3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H21FN6O3S/c1-15-2-5-17(6-3-15)33-20-7-4-16(12-19(20)29(30)31)13-25-27-22-24-14-18(23)21(26-22)28-8-10-32-11-9-28/h2-7,12-14H,8-11H2,1H3,(H,24,26,27)/b25-13+ |
| InChIKey | KYHUOJRRONJFEA-DHRITJCHSA-N |
| XLogP | 4.27 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|