C20H22FN7O — CID 126001855
N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 126001855) has the molecular formula C20H22FN7O and a molecular weight of 395.44 g/mol. Its IUPAC name is N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 126001855 |
| Molecular Formula | C20H22FN7O |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=N\Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H22FN7O/c1-14-17(15(2)28(26-14)16-6-4-3-5-7-16)12-23-25-20-22-13-18(21)19(24-20)27-8-10-29-11-9-27/h3-7,12-13H,8-11H2,1-2H3,(H,22,24,25)/b23-12- |
| InChIKey | BACQXPQKCQIKDN-FMCGGJTJSA-N |
| XLogP | 2.70 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|