C23H26FN5O3 — CID 5005049
N-[(2,7-diethoxynaphthalen-1-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 5005049) has the molecular formula C23H26FN5O3 and a molecular weight of 439.49 g/mol. Its IUPAC name is N-[(2,7-diethoxynaphthalen-1-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(2,7-diethoxynaphthalen-1-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 5005049 |
| Molecular Formula | C23H26FN5O3 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-[(2,7-diethoxynaphthalen-1-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | CCOc1ccc2ccc(OCC)c(C=NNc3ncc(F)c(N4CCOCC4)n3)c2c1 |
| InChI | InChI=1S/C23H26FN5O3/c1-3-31-17-7-5-16-6-8-21(32-4-2)19(18(16)13-17)14-26-28-23-25-15-20(24)22(27-23)29-9-11-30-12-10-29/h5-8,13-15H,3-4,9-12H2,1-2H3,(H,25,27,28) |
| InChIKey | JPIQJBNQECYSMH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|