C28H27FIN5O3 — CID 18773473
N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 18773473) has the molecular formula C28H27FIN5O3 and a molecular weight of 627.46 g/mol. Its IUPAC name is N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 18773473 |
| Molecular Formula | C28H27FIN5O3 |
| Molecular Weight | 627.46 g/mol |
| Exact Mass | 627.11 |
| IUPAC Name | N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H27FIN5O3/c1-2-37-25-15-19(16-32-34-28-31-17-23(29)27(33-28)35-10-12-36-13-11-35)14-24(30)26(25)38-18-21-8-5-7-20-6-3-4-9-22(20)21/h3-9,14-17H,2,10-13,18H2,1H3,(H,31,33,34)/b32-16- |
| InChIKey | SGXFQJAYDITWCN-ZMGVVAQMSA-N |
| XLogP | 5.63 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|