C16H17FIN5O2 — CID 136654701
4-[(Z)-[(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)hydrazinylidene]methyl]-2-iodo-6-methoxyphenol (PubChem CID 136654701) has the molecular formula C16H17FIN5O2 and a molecular weight of 457.25 g/mol. Its IUPAC name is 4-[(Z)-[(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)hydrazinylidene]methyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(Z)-[(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)hydrazinylidene]methyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 136654701 |
| Molecular Formula | C16H17FIN5O2 |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 4-[(Z)-[(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)hydrazinylidene]methyl]-2-iodo-6-methoxyphenol |
| SMILES | COc1cc(/C=N\Nc2ncc(F)c(N3CCCC3)n2)cc(I)c1O |
| InChI | InChI=1S/C16H17FIN5O2/c1-25-13-7-10(6-12(18)14(13)24)8-20-22-16-19-9-11(17)15(21-16)23-4-2-3-5-23/h6-9,24H,2-5H2,1H3,(H,19,21,22)/b20-8- |
| InChIKey | ITDNLXOGCFAASN-ZBKNUEDVSA-N |
| XLogP | 2.98 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|