C17H18FN5O3 — CID 171131811
5-fluoro-N-[(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-4-pyrrolidin-1-ylpyrimidin-2-amine (PubChem CID 171131811) has the molecular formula C17H18FN5O3 and a molecular weight of 359.36 g/mol. Its IUPAC name is 5-fluoro-N-[(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-4-pyrrolidin-1-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-4-pyrrolidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 171131811 |
| Molecular Formula | C17H18FN5O3 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-fluoro-N-[(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-4-pyrrolidin-1-ylpyrimidin-2-amine |
| SMILES | COc1cc(C=NNc2ncc(F)c(N3CCCC3)n2)cc2c1OCO2 |
| InChI | InChI=1S/C17H18FN5O3/c1-24-13-6-11(7-14-15(13)26-10-25-14)8-20-22-17-19-9-12(18)16(21-17)23-4-2-3-5-23/h6-9H,2-5,10H2,1H3,(H,19,21,22) |
| InChIKey | JKSBOHDHKKQQJW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|