C19H16ClF2N7O2 — CID 4136118
N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 4136118) has the molecular formula C19H16ClF2N7O2 and a molecular weight of 447.83 g/mol. Its IUPAC name is N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 4136118 |
| Molecular Formula | C19H16ClF2N7O2 |
| Molecular Weight | 447.83 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Fc1cnc(Cl)nc1Oc1ccc(C=NNc2ncc(F)c(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C19H16ClF2N7O2/c20-18-23-11-15(22)17(27-18)31-13-3-1-12(2-4-13)9-25-28-19-24-10-14(21)16(26-19)29-5-7-30-8-6-29/h1-4,9-11H,5-8H2,(H,24,26,28) |
| InChIKey | JNJKWCNGXFMBQO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.83 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|