C15H14Cl2FN5O2 — CID 135846631
2,4-dichloro-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 135846631) has the molecular formula C15H14Cl2FN5O2 and a molecular weight of 386.21 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135846631 |
| Molecular Formula | C15H14Cl2FN5O2 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2,4-dichloro-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H14Cl2FN5O2/c16-10-5-9(13(24)11(17)6-10)7-20-22-15-19-8-12(18)14(21-15)23-1-3-25-4-2-23/h5-8,24H,1-4H2,(H,19,21,22)/b20-7+ |
| InChIKey | GMLGUPDHGWEOAU-IFRROFPPSA-N |
| XLogP | 2.91 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|