C17H19FIN5O3 — CID 17354247
5-fluoro-N-[(E)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 17354247) has the molecular formula C17H19FIN5O3 and a molecular weight of 487.27 g/mol. Its IUPAC name is 5-fluoro-N-[(E)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(E)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 17354247 |
| Molecular Formula | C17H19FIN5O3 |
| Molecular Weight | 487.27 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 5-fluoro-N-[(E)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | COc1cc(/C=N/Nc2ncc(F)c(N3CCOCC3)n2)cc(I)c1OC |
| InChI | InChI=1S/C17H19FIN5O3/c1-25-14-8-11(7-13(19)15(14)26-2)9-21-23-17-20-10-12(18)16(22-17)24-3-5-27-6-4-24/h7-10H,3-6H2,1-2H3,(H,20,22,23)/b21-9+ |
| InChIKey | WZIVLSRVZWUBCL-ZVBGSRNCSA-N |
| XLogP | 2.52 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|