C24H24FN7O6 — CID 126073844
2-[4-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126073844) has the molecular formula C24H24FN7O6 and a molecular weight of 525.50 g/mol. Its IUPAC name is 2-[4-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[4-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126073844 |
| Molecular Formula | C24H24FN7O6 |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-[4-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1cc(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)ccc1OCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H24FN7O6/c1-36-21-11-16(13-27-30-24-26-14-19(25)23(29-24)31-7-9-37-10-8-31)5-6-20(21)38-15-22(33)28-17-3-2-4-18(12-17)32(34)35/h2-6,11-14H,7-10,15H2,1H3,(H,28,33)(H,26,29,30)/b27-13- |
| InChIKey | YFRAHSQWOKMSLK-WKIKZPBSSA-N |
| XLogP | 2.83 |
| TPSA | 153.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|