C21H22BrFN6O — CID 126071252
N-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 126071252) has the molecular formula C21H22BrFN6O and a molecular weight of 473.35 g/mol. Its IUPAC name is N-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 126071252 |
| Molecular Formula | C21H22BrFN6O |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | N-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Cc1cc(/C=N/Nc2ncc(F)c(N3CCOCC3)n2)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C21H22BrFN6O/c1-14-10-16(15(2)29(14)18-5-3-4-17(22)11-18)12-25-27-21-24-13-19(23)20(26-21)28-6-8-30-9-7-28/h3-5,10-13H,6-9H2,1-2H3,(H,24,26,27)/b25-12+ |
| InChIKey | QNGSNBQSDUICMZ-BRJLIKDPSA-N |
| XLogP | 4.07 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|