C20H17ClFN5O4 — CID 91162168
2-chloro-5-[5-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]furan-2-yl]benzoic acid (PubChem CID 91162168) has the molecular formula C20H17ClFN5O4 and a molecular weight of 445.84 g/mol. Its IUPAC name is 2-chloro-5-[5-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 91162168 |
| Molecular Formula | C20H17ClFN5O4 |
| Molecular Weight | 445.84 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2-chloro-5-[5-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C/N=N/c3ncc(F)c(N4CCOCC4)n3)o2)ccc1Cl |
| InChI | InChI=1S/C20H17ClFN5O4/c21-15-3-1-12(9-14(15)19(28)29)17-4-2-13(31-17)10-24-26-20-23-11-16(22)18(25-20)27-5-7-30-8-6-27/h1-4,9,11H,5-8,10H2,(H,28,29)/b26-24+ |
| InChIKey | JYNSIMOZLXQOTD-SHHOIMCASA-N |
| XLogP | 4.35 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|