C18H12ClFN2O3 — CID 91897850
2-chloro-5-[[5-(4-fluorophenyl)furan-2-yl]methyldiazenyl]benzoic acid (PubChem CID 91897850) has the molecular formula C18H12ClFN2O3 and a molecular weight of 358.76 g/mol. Its IUPAC name is 2-chloro-5-[[5-(4-fluorophenyl)furan-2-yl]methyldiazenyl]benzoic acid.
| Compound Name | 2-chloro-5-[[5-(4-fluorophenyl)furan-2-yl]methyldiazenyl]benzoic acid |
|---|---|
| PubChem CID | 91897850 |
| Molecular Formula | C18H12ClFN2O3 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2-chloro-5-[[5-(4-fluorophenyl)furan-2-yl]methyldiazenyl]benzoic acid |
| SMILES | O=C(O)c1cc(/N=N/Cc2ccc(-c3ccc(F)cc3)o2)ccc1Cl |
| InChI | InChI=1S/C18H12ClFN2O3/c19-16-7-5-13(9-15(16)18(23)24)22-21-10-14-6-8-17(25-14)11-1-3-12(20)4-2-11/h1-9H,10H2,(H,23,24)/b22-21+ |
| InChIKey | ONFGRWBEYQTGRY-QURGRASLSA-N |
| XLogP | 5.72 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|