C19H12Cl2N2O5 — CID 91933090
5-[5-[[(3-carboxy-4-chlorophenyl)diazenyl]methyl]furan-2-yl]-2-chlorobenzoic acid (PubChem CID 91933090) has the molecular formula C19H12Cl2N2O5 and a molecular weight of 419.22 g/mol. Its IUPAC name is 5-[5-[[(3-carboxy-4-chlorophenyl)diazenyl]methyl]furan-2-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[5-[[(3-carboxy-4-chlorophenyl)diazenyl]methyl]furan-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 91933090 |
| Molecular Formula | C19H12Cl2N2O5 |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 5-[5-[[(3-carboxy-4-chlorophenyl)diazenyl]methyl]furan-2-yl]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(/N=N/Cc2ccc(-c3ccc(Cl)c(C(=O)O)c3)o2)ccc1Cl |
| InChI | InChI=1S/C19H12Cl2N2O5/c20-15-4-1-10(7-13(15)18(24)25)17-6-3-12(28-17)9-22-23-11-2-5-16(21)14(8-11)19(26)27/h1-8H,9H2,(H,24,25)(H,26,27)/b23-22+ |
| InChIKey | BSNUGPUYUHABNL-GHVJWSGMSA-N |
| XLogP | 5.93 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|