C23H25FN6O — CID 91250267
3-ethyl-4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-phenylaniline (PubChem CID 91250267) has the molecular formula C23H25FN6O and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-ethyl-4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-phenylaniline.
| Compound Name | 3-ethyl-4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-phenylaniline |
|---|---|
| PubChem CID | 91250267 |
| Molecular Formula | C23H25FN6O |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 3-ethyl-4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-phenylaniline |
| SMILES | CCc1cc(Nc2ccccc2)ccc1C/N=N/c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C23H25FN6O/c1-2-17-14-20(27-19-6-4-3-5-7-19)9-8-18(17)15-26-29-23-25-16-21(24)22(28-23)30-10-12-31-13-11-30/h3-9,14,16,27H,2,10-13,15H2,1H3/b29-26+ |
| InChIKey | SJGBCZGXALTKLP-PBBVDAKRSA-N |
| XLogP | 5.04 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|