C22H21ClFN7O2 — CID 91387785
1-[3-chloro-5-[[6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-pyridinyl]amino]phenyl]ethanone (PubChem CID 91387785) has the molecular formula C22H21ClFN7O2 and a molecular weight of 469.91 g/mol. Its IUPAC name is 1-[3-chloro-5-[[6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-pyridinyl]amino]phenyl]ethanone.
| Compound Name | 1-[3-chloro-5-[[6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-pyridinyl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 91387785 |
| Molecular Formula | C22H21ClFN7O2 |
| Molecular Weight | 469.91 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 1-[3-chloro-5-[[6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-pyridinyl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cc(Cl)cc(Nc2ccc(C/N=N/c3ncc(F)c(N4CCOCC4)n3)nc2)c1 |
| InChI | InChI=1S/C22H21ClFN7O2/c1-14(32)15-8-16(23)10-19(9-15)28-18-3-2-17(25-11-18)12-27-30-22-26-13-20(24)21(29-22)31-4-6-33-7-5-31/h2-3,8-11,13,28H,4-7,12H2,1H3/b30-27+ |
| InChIKey | CMDYUGSVBODDPG-KDJFERLWSA-N |
| XLogP | 4.73 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|