C25H23FN8O — CID 91441124
6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-(4-pyridin-3-ylphenyl)pyridin-3-amine (PubChem CID 91441124) has the molecular formula C25H23FN8O and a molecular weight of 470.51 g/mol. Its IUPAC name is 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-(4-pyridin-3-ylphenyl)pyridin-3-amine.
| Compound Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-(4-pyridin-3-ylphenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 91441124 |
| Molecular Formula | C25H23FN8O |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-(4-pyridin-3-ylphenyl)pyridin-3-amine |
| SMILES | Fc1cnc(/N=N/Cc2ccc(Nc3ccc(-c4cccnc4)cc3)cn2)nc1N1CCOCC1 |
| InChI | InChI=1S/C25H23FN8O/c26-23-17-29-25(32-24(23)34-10-12-35-13-11-34)33-30-16-21-7-8-22(15-28-21)31-20-5-3-18(4-6-20)19-2-1-9-27-14-19/h1-9,14-15,17,31H,10-13,16H2/b33-30+ |
| InChIKey | MWFYBKXYMHTYCB-KKYHWDRJSA-N |
| XLogP | 4.94 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|