C29H24FN7O — CID 90885534
3-[4-[[6-[[[4-(3-ethyl-4-pyridinyl)-5-fluoropyrimidin-2-yl]diazenyl]methyl]-3-pyridinyl]amino]phenyl]phenol (PubChem CID 90885534) has the molecular formula C29H24FN7O and a molecular weight of 505.56 g/mol. Its IUPAC name is 3-[4-[[6-[[[4-(3-ethyl-4-pyridinyl)-5-fluoropyrimidin-2-yl]diazenyl]methyl]-3-pyridinyl]amino]phenyl]phenol.
| Compound Name | 3-[4-[[6-[[[4-(3-ethyl-4-pyridinyl)-5-fluoropyrimidin-2-yl]diazenyl]methyl]-3-pyridinyl]amino]phenyl]phenol |
|---|---|
| PubChem CID | 90885534 |
| Molecular Formula | C29H24FN7O |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 3-[4-[[6-[[[4-(3-ethyl-4-pyridinyl)-5-fluoropyrimidin-2-yl]diazenyl]methyl]-3-pyridinyl]amino]phenyl]phenol |
| SMILES | CCc1cnccc1-c1nc(/N=N/Cc2ccc(Nc3ccc(-c4cccc(O)c4)cc3)cn2)ncc1F |
| InChI | InChI=1S/C29H24FN7O/c1-2-19-15-31-13-12-26(19)28-27(30)18-33-29(36-28)37-34-17-23-10-11-24(16-32-23)35-22-8-6-20(7-9-22)21-4-3-5-25(38)14-21/h3-16,18,35,38H,2,17H2,1H3/b37-34+ |
| InChIKey | IYWZZTVKNODEAD-NFSLGCCLSA-N |
| XLogP | 7.04 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|