C31H33FN6O2 — CID 90991816
3-[4-[4-[[[5-fluoro-4-(3-propan-2-ylmorpholin-4-yl)pyrimidin-2-yl]diazenyl]methyl]-3-methylanilino]phenyl]phenol (PubChem CID 90991816) has the molecular formula C31H33FN6O2 and a molecular weight of 540.64 g/mol. Its IUPAC name is 3-[4-[4-[[[5-fluoro-4-(3-propan-2-ylmorpholin-4-yl)pyrimidin-2-yl]diazenyl]methyl]-3-methylanilino]phenyl]phenol.
| Compound Name | 3-[4-[4-[[[5-fluoro-4-(3-propan-2-ylmorpholin-4-yl)pyrimidin-2-yl]diazenyl]methyl]-3-methylanilino]phenyl]phenol |
|---|---|
| PubChem CID | 90991816 |
| Molecular Formula | C31H33FN6O2 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 3-[4-[4-[[[5-fluoro-4-(3-propan-2-ylmorpholin-4-yl)pyrimidin-2-yl]diazenyl]methyl]-3-methylanilino]phenyl]phenol |
| SMILES | Cc1cc(Nc2ccc(-c3cccc(O)c3)cc2)ccc1C/N=N/c1ncc(F)c(N2CCOCC2C(C)C)n1 |
| InChI | InChI=1S/C31H33FN6O2/c1-20(2)29-19-40-14-13-38(29)30-28(32)18-33-31(36-30)37-34-17-24-9-12-26(15-21(24)3)35-25-10-7-22(8-11-25)23-5-4-6-27(39)16-23/h4-12,15-16,18,20,29,35,39H,13-14,17,19H2,1-3H3/b37-34+ |
| InChIKey | BDLHVMPJGBXEND-NFSLGCCLSA-N |
| XLogP | 7.19 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|