C28H27FN6O2 — CID 91374655
3-[4-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-methylanilino]phenyl]phenol (PubChem CID 91374655) has the molecular formula C28H27FN6O2 and a molecular weight of 498.56 g/mol. Its IUPAC name is 3-[4-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-methylanilino]phenyl]phenol.
| Compound Name | 3-[4-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-methylanilino]phenyl]phenol |
|---|---|
| PubChem CID | 91374655 |
| Molecular Formula | C28H27FN6O2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 3-[4-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-methylanilino]phenyl]phenol |
| SMILES | Cc1cc(Nc2ccc(-c3cccc(O)c3)cc2)ccc1C/N=N/c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C28H27FN6O2/c1-19-15-24(32-23-8-5-20(6-9-23)21-3-2-4-25(36)16-21)10-7-22(19)17-31-34-28-30-18-26(29)27(33-28)35-11-13-37-14-12-35/h2-10,15-16,18,32,36H,11-14,17H2,1H3/b34-31+ |
| InChIKey | IXFMCVXRRFCQIF-WUVHBKSUSA-N |
| XLogP | 6.16 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|