C31H30F4N6O2 — CID 91099128
3-[3-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-propan-2-ylanilino]-5-(trifluoromethyl)phenyl]phenol (PubChem CID 91099128) has the molecular formula C31H30F4N6O2 and a molecular weight of 594.61 g/mol. Its IUPAC name is 3-[3-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-propan-2-ylanilino]-5-(trifluoromethyl)phenyl]phenol.
| Compound Name | 3-[3-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-propan-2-ylanilino]-5-(trifluoromethyl)phenyl]phenol |
|---|---|
| PubChem CID | 91099128 |
| Molecular Formula | C31H30F4N6O2 |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | 3-[3-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-propan-2-ylanilino]-5-(trifluoromethyl)phenyl]phenol |
| SMILES | CC(C)c1cc(Nc2cc(-c3cccc(O)c3)cc(C(F)(F)F)c2)ccc1C/N=N/c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C31H30F4N6O2/c1-19(2)27-16-24(38-25-13-22(12-23(15-25)31(33,34)35)20-4-3-5-26(42)14-20)7-6-21(27)17-37-40-30-36-18-28(32)29(39-30)41-8-10-43-11-9-41/h3-7,12-16,18-19,38,42H,8-11,17H2,1-2H3/b40-37+ |
| InChIKey | ALIXOAKESHZVGZ-UKRDSVFVSA-N |
| XLogP | 7.99 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|