C21H22FN5O3 — CID 170920906
(2,7-dimethoxynaphthalen-1-yl)methyl-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazene (PubChem CID 170920906) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is (2,7-dimethoxynaphthalen-1-yl)methyl-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazene.
| Compound Name | (2,7-dimethoxynaphthalen-1-yl)methyl-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazene |
|---|---|
| PubChem CID | 170920906 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (2,7-dimethoxynaphthalen-1-yl)methyl-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazene |
| SMILES | COc1ccc2ccc(OC)c(C/N=N/c3ncc(F)c(N4CCOCC4)n3)c2c1 |
| InChI | InChI=1S/C21H22FN5O3/c1-28-15-5-3-14-4-6-19(29-2)17(16(14)11-15)12-24-26-21-23-13-18(22)20(25-21)27-7-9-30-10-8-27/h3-6,11,13H,7-10,12H2,1-2H3/b26-24+ |
| InChIKey | VWWNMUVFYJGSGO-SHHOIMCASA-N |
| XLogP | 3.91 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|